CAS 220941-93-5 appears in our catalog under these names: CP 226,269, CP-226269/ 99.08% (existing batch purity), CP-226269, 5-Fluoro-2-((4-(pyridin-2-yl)piperazin-1-yl)methyl)-1H-indole, 95%, 95%, CP 226269, 99.65%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 500mg, 250mg.
5-fluoro-2-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-1H-indole (CAS 220941-93-5) is a chemical compound with the molecular formula C18H19FN4 and a molecular weight of 310.4 g/mol. IUPAC name: 5-fluoro-2-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-1H-indole. InChIKey: PQOIDBZLMJMYCD-UHFFFAOYSA-N.
| Molecular formula | C18H19FN4 |
|---|---|
| Molecular weight | 310.4 g/mol |
| IUPAC name | 5-fluoro-2-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-1H-indole |
| InChIKey | PQOIDBZLMJMYCD-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CC2=CC3=C(N2)C=CC(=C3)F)C4=CC=CC=N4 |
Computed by PubChem (NCBI)