CAS 230954-09-3 appears in our catalog under these names: CP–544439, CP-544439/ 98.11% (existing batch purity), CP-544439. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 1 mg, 10 mg, 5 mg.
4-[[4-(4-fluorophenoxy)phenyl]sulfonylamino]-N-hydroxyoxane-4-carboxamide (CAS 230954-09-3) is a chemical compound with the molecular formula C18H19FN2O6S and a molecular weight of 410.4 g/mol. IUPAC name: 4-[[4-(4-fluorophenoxy)phenyl]sulfonylamino]-N-hydroxyoxane-4-carboxamide. InChIKey: ZBRHTUMWSDPCMI-UHFFFAOYSA-N.
| Molecular formula | C18H19FN2O6S |
|---|---|
| Molecular weight | 410.4 g/mol |
| IUPAC name | 4-[[4-(4-fluorophenoxy)phenyl]sulfonylamino]-N-hydroxyoxane-4-carboxamide |
| InChIKey | ZBRHTUMWSDPCMI-UHFFFAOYSA-N |
| SMILES | C1COCCC1(C(=O)NO)NS(=O)(=O)C2=CC=C(C=C2)OC3=CC=C(C=C3)F |
Computed by PubChem (NCBI)