Products 2131091-31-9
CAS 2131091-31-9 appears in our catalog under these names: CPD2028/ 99.29% (existing batch purity), CPD2028. Offered by: TargetMol, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg.
Tert-butyl 2-methyl-2-[5-methyl-6-(1,3-oxazol-2-yl)-2,4-dioxo-1H-thieno[2,3-d]pyrimidin-3-yl]propanoate (CAS 2131091-31-9) is a chemical compound with the molecular formula C18H21N3O5S and a molecular weight of 391.4 g/mol. IUPAC name: tert-butyl 2-methyl-2-[5-methyl-6-(1,3-oxazol-2-yl)-2,4-dioxo-1H-thieno[2,3-d]pyrimidin-3-yl]propanoate. InChIKey: YQKKPOHWXWJHFG-UHFFFAOYSA-N.
| Molecular formula | C18H21N3O5S |
|---|---|
| Molecular weight | 391.4 g/mol |
| IUPAC name | tert-butyl 2-methyl-2-[5-methyl-6-(1,3-oxazol-2-yl)-2,4-dioxo-1H-thieno[2,3-d]pyrimidin-3-yl]propanoate |
| InChIKey | YQKKPOHWXWJHFG-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=C1C(=O)N(C(=O)N2)C(C)(C)C(=O)OC(C)(C)C)C3=NC=CO3 |
Computed by PubChem (NCBI)
Synonyms:
orb1219466, orb1298659