CAS 693288-97-0 appears in our catalog under these names: Ns 11394, 95%, CPPHA, 98%, CPPHA/ 99.61% (existing batch purity), CPPHA, CPPHA 99%. Offered by: Combi-blocks, AmBeed, TargetMol, GLPBio, Biosynth. Available pack sizes: 500mg, 100mg, 5mg, 10mg, 10mM (in 1ml dmso), 50mg, 25mg, 250mg.
N-[4-chloro-2-[(1,3-dioxoisoindol-2-yl)methyl]phenyl]-2-hydroxybenzamide (CAS 693288-97-0) is a chemical compound with the molecular formula C22H15ClN2O4 and a molecular weight of 406.8 g/mol. IUPAC name: N-[4-chloro-2-[(1,3-dioxoisoindol-2-yl)methyl]phenyl]-2-hydroxybenzamide. InChIKey: UFOUABRZSDGGAZ-UHFFFAOYSA-N.
| Molecular formula | C22H15ClN2O4 |
|---|---|
| Molecular weight | 406.8 g/mol |
| IUPAC name | N-[4-chloro-2-[(1,3-dioxoisoindol-2-yl)methyl]phenyl]-2-hydroxybenzamide |
| InChIKey | UFOUABRZSDGGAZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CC3=C(C=CC(=C3)Cl)NC(=O)C4=CC=CC=C4O |
Computed by PubChem (NCBI)