Products 913827-99-3
CAS 913827-99-3 appears in our catalog under these names: CS-2100, 99%, 99%, CS-2100 99%, CS 2100/ 98.13% (existing batch purity), CS 2100, CS 2100. Offered by: Chemat, Ambeed, TargetMol, GLPBio, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg, 2mg, 5mg, 25 mg.
1-[[4-ethyl-5-[5-(4-phenoxyphenyl)-1,2,4-oxadiazol-3-yl]thiophen-2-yl]methyl]azetidine-3-carboxylic acid (CAS 913827-99-3) is a chemical compound with the molecular formula C25H23N3O4S and a molecular weight of 461.5 g/mol. IUPAC name: 1-[[4-ethyl-5-[5-(4-phenoxyphenyl)-1,2,4-oxadiazol-3-yl]thiophen-2-yl]methyl]azetidine-3-carboxylic acid. InChIKey: DWVJASHDNJMDNH-UHFFFAOYSA-N.
| Molecular formula | C25H23N3O4S |
|---|---|
| Molecular weight | 461.5 g/mol |
| IUPAC name | 1-[[4-ethyl-5-[5-(4-phenoxyphenyl)-1,2,4-oxadiazol-3-yl]thiophen-2-yl]methyl]azetidine-3-carboxylic acid |
| InChIKey | DWVJASHDNJMDNH-UHFFFAOYSA-N |
| SMILES | CCC1=C(SC(=C1)CN2CC(C2)C(=O)O)C3=NOC(=N3)C4=CC=C(C=C4)OC5=CC=CC=C5 |
Computed by PubChem (NCBI)