CAS 1983924-33-9 appears in our catalog under these names: CT-1/ 99.24% (existing batch purity), CT-1, Anticancer agent 253. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 25 mg, 50 mg.
(3E,5E)-3,5-bis[(2-fluorophenyl)methylidene]-1-[[1-[(4-fluorophenyl)methyl]triazol-4-yl]methyl]piperidin-4-one (CAS 1983924-33-9) is a chemical compound with the molecular formula C29H23F3N4O and a molecular weight of 500.5 g/mol. IUPAC name: (3E,5E)-3,5-bis[(2-fluorophenyl)methylidene]-1-[[1-[(4-fluorophenyl)methyl]triazol-4-yl]methyl]piperidin-4-one. InChIKey: GRSQHVJEBDBQLN-RNIAWFEPSA-N.
| Molecular formula | C29H23F3N4O |
|---|---|
| Molecular weight | 500.5 g/mol |
| IUPAC name | (3E,5E)-3,5-bis[(2-fluorophenyl)methylidene]-1-[[1-[(4-fluorophenyl)methyl]triazol-4-yl]methyl]piperidin-4-one |
| InChIKey | GRSQHVJEBDBQLN-RNIAWFEPSA-N |
| SMILES | C\1N(C/C(=C\C2=CC=CC=C2F)/C(=O)/C1=C/C3=CC=CC=C3F)CC4=CN(N=N4)CC5=CC=C(C=C5)F |
Computed by PubChem (NCBI)