CAS 2109805-75-4 appears in our catalog under these names: CU-CPT17e/ 99.18% (existing batch purity), CU-CPT17e, 6,7-Bis((4-nitrobenzyl)oxy)-2',3',5',6'-tetrahydrospiro[chromene-2,4'-pyran], 95%, 95%, CU-CPT17e, 99.00%, CU-CPT17e (Standard). Offered by: TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 5 mg, 1 mg.
6,7-bis[(4-nitrophenyl)methoxy]spiro[chromene-2,4'-oxane] (CAS 2109805-75-4) is a chemical compound with the molecular formula C27H24N2O8 and a molecular weight of 504.5 g/mol. IUPAC name: 6,7-bis[(4-nitrophenyl)methoxy]spiro[chromene-2,4'-oxane]. InChIKey: LHTNFHWDTHQECR-UHFFFAOYSA-N.
| Molecular formula | C27H24N2O8 |
|---|---|
| Molecular weight | 504.5 g/mol |
| IUPAC name | 6,7-bis[(4-nitrophenyl)methoxy]spiro[chromene-2,4'-oxane] |
| InChIKey | LHTNFHWDTHQECR-UHFFFAOYSA-N |
| SMILES | C1COCCC12C=CC3=CC(=C(C=C3O2)OCC4=CC=C(C=C4)[N+](=O)[O-])OCC5=CC=C(C=C5)[N+](=O)[O-] |
Computed by PubChem (NCBI)