cas: 5294-61-1 — see every product listed under this CAS number, including other names
CVT-2738, 99.81% (CAS 5294-61-1) is a chemical reagent available from Chemat. Available pack sizes: 5 g, 200 mg, 10mM/1mL, 1 g, 100 mg, 500 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W009512-5 g |
| cas | 5294-61-1 |
| size | 5 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 g | 1081.31 Pln | |
| MedChemExpress | 200 mg | 273.25 Pln | |
| MedChemExpress | 10mM/1mL | 250.03 Pln | |
| MedChemExpress | 1 g | 505.45 Pln | |
| MedChemExpress | 100 mg | 240.74 Pln | |
| MedChemExpress | 500 mg | 361.49 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.81% |
N-(2,6-dimethylphenyl)-2-piperazin-1-ylacetamide (CAS 5294-61-1) is a chemical compound with the molecular formula C14H21N3O and a molecular weight of 247.34 g/mol. IUPAC name: N-(2,6-dimethylphenyl)-2-piperazin-1-ylacetamide. InChIKey: NJKRFQIWDJSYOK-UHFFFAOYSA-N.
| Molecular formula | C14H21N3O |
|---|---|
| Molecular weight | 247.34 g/mol |
| IUPAC name | N-(2,6-dimethylphenyl)-2-piperazin-1-ylacetamide |
| InChIKey | NJKRFQIWDJSYOK-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)NC(=O)CN2CCNCC2 |
Computed by PubChem (NCBI)