cas: 5294-61-1 — see every product listed under this CAS number, including other names
N-(2,6-Dimethylphenyl)-2-(piperazin-1-yl)acetamide, 98%, 98% (CAS 5294-61-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114S9D-1g |
| cas | 5294-61-1 |
| size | 1g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 122.00 Pln | |
| Chemat | 10g | 160.40 Pln | |
| Chemat | 100g | 554.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
N-(2,6-dimethylphenyl)-2-piperazin-1-ylacetamide (CAS 5294-61-1) is a chemical compound with the molecular formula C14H21N3O and a molecular weight of 247.34 g/mol. IUPAC name: N-(2,6-dimethylphenyl)-2-piperazin-1-ylacetamide. InChIKey: NJKRFQIWDJSYOK-UHFFFAOYSA-N.
| Molecular formula | C14H21N3O |
|---|---|
| Molecular weight | 247.34 g/mol |
| IUPAC name | N-(2,6-dimethylphenyl)-2-piperazin-1-ylacetamide |
| InChIKey | NJKRFQIWDJSYOK-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)NC(=O)CN2CCNCC2 |
Computed by PubChem (NCBI)