CAS 205187-53-7 appears in our catalog under these names: CX-157/ 99.35% (existing batch purity), CX–157, 3-Fluoro-7-(2,2,2-trifluoroethoxy)phenoxathiine 10,10-dioxide, CX-157. Offered by: TargetMol, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 5 mg, 10 mg, 1 mg.
3-fluoro-7-(2,2,2-trifluoroethoxy)phenoxathiine 10,10-dioxide (CAS 205187-53-7) is a chemical compound with the molecular formula C14H8F4O4S and a molecular weight of 348.27 g/mol. IUPAC name: 3-fluoro-7-(2,2,2-trifluoroethoxy)phenoxathiine 10,10-dioxide. InChIKey: PDIMOTRDGUQMNY-UHFFFAOYSA-N.
| Molecular formula | C14H8F4O4S |
|---|---|
| Molecular weight | 348.27 g/mol |
| IUPAC name | 3-fluoro-7-(2,2,2-trifluoroethoxy)phenoxathiine 10,10-dioxide |
| InChIKey | PDIMOTRDGUQMNY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1OCC(F)(F)F)OC3=C(S2(=O)=O)C=CC(=C3)F |
Computed by PubChem (NCBI)