CAS 1873376-49-8 appears in our catalog under these names: CXCR2-IN-1/ 99.53% (existing batch purity), CXCR2–IN–1, CXCR2-IN-1, CXCR2-IN-1 99%, CXCR2-IN-1, 99.54%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 2mg.
1-(2-chloro-3-fluorophenyl)-3-[4-chloro-2-hydroxy-3-(1-methylpiperidin-4-yl)sulfonylphenyl]urea (CAS 1873376-49-8) is a chemical compound with the molecular formula C19H20Cl2FN3O4S and a molecular weight of 476.3 g/mol. IUPAC name: 1-(2-chloro-3-fluorophenyl)-3-[4-chloro-2-hydroxy-3-(1-methylpiperidin-4-yl)sulfonylphenyl]urea. InChIKey: BJYOBCUGMDKPBM-UHFFFAOYSA-N.
| Molecular formula | C19H20Cl2FN3O4S |
|---|---|
| Molecular weight | 476.3 g/mol |
| IUPAC name | 1-(2-chloro-3-fluorophenyl)-3-[4-chloro-2-hydroxy-3-(1-methylpiperidin-4-yl)sulfonylphenyl]urea |
| InChIKey | BJYOBCUGMDKPBM-UHFFFAOYSA-N |
| SMILES | CN1CCC(CC1)S(=O)(=O)C2=C(C=CC(=C2O)NC(=O)NC3=C(C(=CC=C3)F)Cl)Cl |
Computed by PubChem (NCBI)