CAS 1421365-63-0 appears in our catalog under these names: CYM 50769/ 98.17% (existing batch purity), CYM 50769, CYM 50769, CYM 50769 99%, CYM 50769, 99%, 99%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 25 mg.
5-chloro-2-(9H-fluoren-9-yl)-4-(4-methoxyphenoxy)pyridazin-3-one (CAS 1421365-63-0) is a chemical compound with the molecular formula C24H17ClN2O3 and a molecular weight of 416.9 g/mol. IUPAC name: 5-chloro-2-(9H-fluoren-9-yl)-4-(4-methoxyphenoxy)pyridazin-3-one. InChIKey: QHVSQUYCVUHYKT-UHFFFAOYSA-N.
| Molecular formula | C24H17ClN2O3 |
|---|---|
| Molecular weight | 416.9 g/mol |
| IUPAC name | 5-chloro-2-(9H-fluoren-9-yl)-4-(4-methoxyphenoxy)pyridazin-3-one |
| InChIKey | QHVSQUYCVUHYKT-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)OC2=C(C=NN(C2=O)C3C4=CC=CC=C4C5=CC=CC=C35)Cl |
Computed by PubChem (NCBI)