CAS 1355026-60-6 appears in our catalog under these names: CYM50260/ 99.88% (existing batch purity), CYM 50260, CYM 50260, CYM50260 97%, CYM50260, 97%, 97%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 10mM/1mL.
2-chloro-3-[2-(2,4-dichlorophenoxy)ethoxy]-6-(fluoromethyl)pyridine (CAS 1355026-60-6) is a chemical compound with the molecular formula C14H11Cl3FNO2 and a molecular weight of 350.6 g/mol. IUPAC name: 2-chloro-3-[2-(2,4-dichlorophenoxy)ethoxy]-6-(fluoromethyl)pyridine. InChIKey: FHPOTBQOUBMMCI-UHFFFAOYSA-N.
| Molecular formula | C14H11Cl3FNO2 |
|---|---|
| Molecular weight | 350.6 g/mol |
| IUPAC name | 2-chloro-3-[2-(2,4-dichlorophenoxy)ethoxy]-6-(fluoromethyl)pyridine |
| InChIKey | FHPOTBQOUBMMCI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)OCCOC2=C(N=C(C=C2)CF)Cl |
Computed by PubChem (NCBI)