CYM50308, 97%
cas: 1345858-76-5 — see every product listed under this CAS number, including other names
CYM50308, 97% (CAS 1345858-76-5) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1148132-5mg |
| cas | 1345858-76-5 |
| size | 5mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5mg | 576.19 Pln | |
| Ambeed | 10mg | 826.50 Pln | |
| Ambeed | 25mg | 1510.69 Pln | |
| Ambeed | 50mg | 2228.25 Pln | |
| Ambeed | 100mg | 3307.38 Pln | |
| Ambeed | 250mg | 6222.12 Pln | |
| Chemat | 5mg | 573.20 Pln | |
| Chemat | 10mg | 827.60 Pln | |
| Chemat | 25mg | 1514.00 Pln | |
| Chemat | 50mg | 2238.80 Pln | |
| Chemat | 100mg | 3323.60 Pln | |
| Chemat | 250mg | 6256.40 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
(5Z)-5-[[1-(2,4-difluorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-(2-methoxyethylimino)-3-methyl-1,3-thiazolidin-4-one (CAS 1345858-76-5) is a chemical compound with the molecular formula C20H21F2N3O2S and a molecular weight of 405.5 g/mol. IUPAC name: (5Z)-5-[[1-(2,4-difluorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-(2-methoxyethylimino)-3-methyl-1,3-thiazolidin-4-one. InChIKey: BKQZKTRCUAWRHT-ONBPWHQPSA-N.
| Molecular formula | C20H21F2N3O2S |
|---|---|
| Molecular weight | 405.5 g/mol |
| IUPAC name | (5Z)-5-[[1-(2,4-difluorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-(2-methoxyethylimino)-3-methyl-1,3-thiazolidin-4-one |
| InChIKey | BKQZKTRCUAWRHT-ONBPWHQPSA-N |
| SMILES | CC1=CC(=C(N1C2=C(C=C(C=C2)F)F)C)/C=C\3/C(=O)N(C(=NCCOC)S3)C |
Computed by PubChem (NCBI)