Products 1345858-76-5
CAS 1345858-76-5 appears in our catalog under these names: CYM 50308, CYM50308/ 99.43% (existing batch purity), CYM 50308, CYM50308, 97%, 97%, CYM50308, 98.0%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso).
(5Z)-5-[[1-(2,4-difluorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-(2-methoxyethylimino)-3-methyl-1,3-thiazolidin-4-one (CAS 1345858-76-5) is a chemical compound with the molecular formula C20H21F2N3O2S and a molecular weight of 405.5 g/mol. IUPAC name: (5Z)-5-[[1-(2,4-difluorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-(2-methoxyethylimino)-3-methyl-1,3-thiazolidin-4-one. InChIKey: BKQZKTRCUAWRHT-ONBPWHQPSA-N.
| Molecular formula | C20H21F2N3O2S |
|---|---|
| Molecular weight | 405.5 g/mol |
| IUPAC name | (5Z)-5-[[1-(2,4-difluorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-(2-methoxyethylimino)-3-methyl-1,3-thiazolidin-4-one |
| InChIKey | BKQZKTRCUAWRHT-ONBPWHQPSA-N |
| SMILES | CC1=CC(=C(N1C2=C(C=C(C=C2)F)F)C)/C=C\3/C(=O)N(C(=NCCOC)S3)C |
Computed by PubChem (NCBI)