CYM50374
cas: 1314212-81-1 — see every product listed under this CAS number, including other names
CYM50374 (CAS 1314212-81-1) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 5 mg. Offered by: TargetMol, MedChemExpress, Chemat.
| brand | TargetMol |
|---|---|
| catalog number | T27106-1mg |
| cas | 1314212-81-1 |
| size | 1mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| TargetMol | 1mg | 2404.70 Pln | |
| TargetMol | 5mg | 5419.94 Pln | |
| TargetMol | 10mg | 7325.57 Pln | |
| TargetMol | 25mg | 10227.90 Pln | |
| TargetMol | 50mg | 12691.41 Pln | |
| TargetMol | 100mg | 15972.19 Pln | |
| TargetMol | 500mg | 31113.26 Pln | |
| MedChemExpress | 5 mg | 7545.76 Pln | |
| MedChemExpress | 10 mg | 10397.17 Pln | |
| MedChemExpress | 1 mg | 3217.55 Pln | |
| Chemat | 1mg | 1024.40 Pln | |
| Chemat | 5mg | 2373.20 Pln | |
| Chemat | 10mg | 3270.80 Pln | |
| Chemat | 25mg | 4682.00 Pln |
properties
| purity | No data |
|---|---|
| delivery time | approx. 15 days |
N-[4-(hydroxymethyl)-2,6-dimethylphenyl]-5-(3-methylthiophen-2-yl)furan-2-carboxamide (CAS 1314212-81-1) is a chemical compound with the molecular formula C19H19NO3S and a molecular weight of 341.4 g/mol. IUPAC name: N-[4-(hydroxymethyl)-2,6-dimethylphenyl]-5-(3-methylthiophen-2-yl)furan-2-carboxamide. InChIKey: WZURXOGFFAAWHL-UHFFFAOYSA-N.
| Molecular formula | C19H19NO3S |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | N-[4-(hydroxymethyl)-2,6-dimethylphenyl]-5-(3-methylthiophen-2-yl)furan-2-carboxamide |
| InChIKey | WZURXOGFFAAWHL-UHFFFAOYSA-N |
| SMILES | CC1=C(SC=C1)C2=CC=C(O2)C(=O)NC3=C(C=C(C=C3C)CO)C |
Computed by PubChem (NCBI)
Synonyms:
orb1700781