Products 2680769-58-6
CAS 2680769-58-6 is the registry number for tert-Butyl 2-acetyl-10H-phenothiazine-10-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 2-acetylphenothiazine-10-carboxylate (CAS 2680769-58-6) is a chemical compound with the molecular formula C19H19NO3S and a molecular weight of 341.4 g/mol. IUPAC name: tert-butyl 2-acetylphenothiazine-10-carboxylate. InChIKey: SOFGIABOZBYOHC-UHFFFAOYSA-N.
| Molecular formula | C19H19NO3S |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | tert-butyl 2-acetylphenothiazine-10-carboxylate |
| InChIKey | SOFGIABOZBYOHC-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(C=C1)SC3=CC=CC=C3N2C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)