CAS 52789-62-5 appears in our catalog under these names: 1-Amino-8-naphthol-2,4-disulfonic acid monosodium salt, 95%, CaMKP inhibitor sodium, 85%, 1–Amino–8–naphthol–2,4–disulfonic Acid Monosodium Salt Hydrate, CaMKP Inhibitor/ 96.55% (existing batch purity), 1-Amino-8-naphthol-2,4-disulfonic acid sodium. Offered by: Combi-blocks, AmBeed, GLPBio, TargetMol, Biosynth. Available pack sizes: 500g, 1g, 100g, 25g, 5g, 1mg, 5mg, 10mg.
Sodium 4-amino-5-hydroxy-3-sulfonaphthalene-1-sulfonate (CAS 52789-62-5) is a chemical compound with the molecular formula C10H8NNaO7S2 and a molecular weight of 341.3 g/mol. IUPAC name: sodium 4-amino-5-hydroxy-3-sulfonaphthalene-1-sulfonate. InChIKey: JOVLEOXYYWEEEW-UHFFFAOYSA-M.
| Molecular formula | C10H8NNaO7S2 |
|---|---|
| Molecular weight | 341.3 g/mol |
| IUPAC name | sodium 4-amino-5-hydroxy-3-sulfonaphthalene-1-sulfonate |
| InChIKey | JOVLEOXYYWEEEW-UHFFFAOYSA-M |
| SMILES | C1=CC2=C(C(=C1)O)C(=C(C=C2S(=O)(=O)[O-])S(=O)(=O)O)N.[Na+] |
Computed by PubChem (NCBI)