Products 874370-15-7
CAS 874370-15-7 appears in our catalog under these names: Calcium Channel antagonist 2/ 99.34% (existing batch purity), Calcium Channel antagonist 2, Calcium Channel antagonist 2 99%, Calcium Channel Antagonist 2, ≥98%, ≥98%, Calcium Channel antagonist 2, 98.0%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 5mg, 250mg, 10 mg.
N-[(4-fluorophenyl)methyl]-3-methyl-5-(4-methylpiperidin-1-yl)sulfonyl-1-benzofuran-2-carboxamide (CAS 874370-15-7) is a chemical compound with the molecular formula C23H25FN2O4S and a molecular weight of 444.5 g/mol. IUPAC name: N-[(4-fluorophenyl)methyl]-3-methyl-5-(4-methylpiperidin-1-yl)sulfonyl-1-benzofuran-2-carboxamide. InChIKey: JMKMEDRXKRPMHV-UHFFFAOYSA-N.
| Molecular formula | C23H25FN2O4S |
|---|---|
| Molecular weight | 444.5 g/mol |
| IUPAC name | N-[(4-fluorophenyl)methyl]-3-methyl-5-(4-methylpiperidin-1-yl)sulfonyl-1-benzofuran-2-carboxamide |
| InChIKey | JMKMEDRXKRPMHV-UHFFFAOYSA-N |
| SMILES | CC1CCN(CC1)S(=O)(=O)C2=CC3=C(C=C2)OC(=C3C)C(=O)NCC4=CC=C(C=C4)F |
Computed by PubChem (NCBI)