Products 687573-14-4
CAS 687573-14-4 appears in our catalog under these names: Calcium Channel antagonist 3, 98%, Calcium Channel antagonist 3/ 100%, Calcium Channel antagonist 3, Calcium Channel antagonist 3, ≥98%, ≥98%, Calcium Channel antagonist 3, 98.0%. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 250mg, 10 mg.
N-benzyl-3-methyl-5-(3-methylpiperidin-1-yl)sulfonyl-1-benzofuran-2-carboxamide (CAS 687573-14-4) is a chemical compound with the molecular formula C23H26N2O4S and a molecular weight of 426.5 g/mol. IUPAC name: N-benzyl-3-methyl-5-(3-methylpiperidin-1-yl)sulfonyl-1-benzofuran-2-carboxamide. InChIKey: JPAQHVPMJBXAMI-UHFFFAOYSA-N.
| Molecular formula | C23H26N2O4S |
|---|---|
| Molecular weight | 426.5 g/mol |
| IUPAC name | N-benzyl-3-methyl-5-(3-methylpiperidin-1-yl)sulfonyl-1-benzofuran-2-carboxamide |
| InChIKey | JPAQHVPMJBXAMI-UHFFFAOYSA-N |
| SMILES | CC1CCCN(C1)S(=O)(=O)C2=CC3=C(C=C2)OC(=C3C)C(=O)NCC4=CC=CC=C4 |
Computed by PubChem (NCBI)