cas: 58131-47-8 — see every product listed under this CAS number, including other names
Calcium Methanesulfonate, >98.0%(T) (CAS 58131-47-8) is a chemical reagent available from Chemat. Available pack sizes: 25g, 500g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | M0549-25G |
| cas | 58131-47-8 |
| size | 25g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25g | 477.30 Pln | |
| TCI | 500g | 4116.07 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(T) |
Calcium methanesulfonate (CAS 58131-47-8) is a chemical compound with the molecular formula C2H6CaO6S2 and a molecular weight of 230.3 g/mol. IUPAC name: calcium methanesulfonate. InChIKey: BWEYVLQUNDGUEC-UHFFFAOYSA-L.
| Molecular formula | C2H6CaO6S2 |
|---|---|
| Molecular weight | 230.3 g/mol |
| IUPAC name | calcium methanesulfonate |
| InChIKey | BWEYVLQUNDGUEC-UHFFFAOYSA-L |
| SMILES | CS(=O)(=O)[O-].CS(=O)(=O)[O-].[Ca+2] |
Computed by PubChem (NCBI)