cas: 58131-47-8 — see every product listed under this CAS number, including other names
Methanesulfonicacidcalciumsalt, 98%, 98% (CAS 58131-47-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114RI1-1g |
| cas | 58131-47-8 |
| size | 1g |
| availability | 150g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 88.40 Pln | |
| Chemat | 25g | 208.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Calcium methanesulfonate (CAS 58131-47-8) is a chemical compound with the molecular formula C2H6CaO6S2 and a molecular weight of 230.3 g/mol. IUPAC name: calcium methanesulfonate. InChIKey: BWEYVLQUNDGUEC-UHFFFAOYSA-L.
| Molecular formula | C2H6CaO6S2 |
|---|---|
| Molecular weight | 230.3 g/mol |
| IUPAC name | calcium methanesulfonate |
| InChIKey | BWEYVLQUNDGUEC-UHFFFAOYSA-L |
| SMILES | CS(=O)(=O)[O-].CS(=O)(=O)[O-].[Ca+2] |
Computed by PubChem (NCBI)