cas: 5743-36-2 — see every product listed under this CAS number, including other names
Calcium butyrate 95% (CAS 5743-36-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A428688-1g |
| cas | 5743-36-2 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 181.25 Pln | |
| Ambeed | 5g | 353.69 Pln | |
| Ambeed | 10g | 492.75 Pln | |
| Ambeed | 25g | 921.06 Pln | |
| Ambeed | 100g | 2628.75 Pln | |
| Ambeed | 500g | 10316.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A428688 |
Calcium butanoate (CAS 5743-36-2) is a chemical compound with the molecular formula C8H14CaO4 and a molecular weight of 214.27 g/mol. IUPAC name: calcium butanoate. InChIKey: FYPVXEILSNEKOO-UHFFFAOYSA-L.
| Molecular formula | C8H14CaO4 |
|---|---|
| Molecular weight | 214.27 g/mol |
| IUPAC name | calcium butanoate |
| InChIKey | FYPVXEILSNEKOO-UHFFFAOYSA-L |
| SMILES | CCCC(=O)[O-].CCCC(=O)[O-].[Ca+2] |
Computed by PubChem (NCBI)