CAS 5743-36-2 appears in our catalog under these names: Calcium butyrate, 95%, Calcium Butyrate (~90%), Calcium butyrate, Calcium butyrate, Calcium butyrate 95%. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, Ambeed. Available pack sizes: 25g, 500g, 100g, 5g, 50g, 1g, 10g.
Calcium butanoate (CAS 5743-36-2) is a chemical compound with the molecular formula C8H14CaO4 and a molecular weight of 214.27 g/mol. IUPAC name: calcium butanoate. InChIKey: FYPVXEILSNEKOO-UHFFFAOYSA-L.
| Molecular formula | C8H14CaO4 |
|---|---|
| Molecular weight | 214.27 g/mol |
| IUPAC name | calcium butanoate |
| InChIKey | FYPVXEILSNEKOO-UHFFFAOYSA-L |
| SMILES | CCCC(=O)[O-].CCCC(=O)[O-].[Ca+2] |
Computed by PubChem (NCBI)