Products 1185237-43-7
CAS 1185237-43-7 appears in our catalog under these names: cis-Capsaicin-d3, Capsaicin-d3 (E/Z-Mixture), >95% (HPLC), Capsaicin-d3, (E/Z)-Capsaicin-d3. Offered by: Hubei YoungXin, TRC, Biosynth, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 75mg, 2mg.
(E)-N-[[4-hydroxy-3-(trideuteriomethoxy)phenyl]methyl]-8-methylnon-6-enamide (CAS 1185237-43-7) is a chemical compound with the molecular formula C18H27NO3 and a molecular weight of 308.4 g/mol. IUPAC name: (E)-N-[[4-hydroxy-3-(trideuteriomethoxy)phenyl]methyl]-8-methylnon-6-enamide. InChIKey: YKPUWZUDDOIDPM-HPFTVYJYSA-N.
| Molecular formula | C18H27NO3 |
|---|---|
| Molecular weight | 308.4 g/mol |
| IUPAC name | (E)-N-[[4-hydroxy-3-(trideuteriomethoxy)phenyl]methyl]-8-methylnon-6-enamide |
| InChIKey | YKPUWZUDDOIDPM-HPFTVYJYSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C=CC(=C1)CNC(=O)CCCC/C=C/C(C)C)O |
Computed by PubChem (NCBI)