cas: 1379546-46-9 — see every product listed under this CAS number, including other names
CarbaMic acid, N-[(1S)-1-(3-chlorophenyl)-2-hydroxyethyl]-, 1,1-diMethylethyl ester, 97%, 97% (CAS 1379546-46-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IMOY-100mg |
| cas | 1379546-46-9 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 174.80 Pln | |
| Chemat | 5g | 611.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[(1S)-1-(3-chlorophenyl)-2-hydroxyethyl]carbamate (CAS 1379546-46-9) is a chemical compound with the molecular formula C13H18ClNO3 and a molecular weight of 271.74 g/mol. IUPAC name: tert-butyl N-[(1S)-1-(3-chlorophenyl)-2-hydroxyethyl]carbamate. InChIKey: SWYMATJMMKRYJJ-LLVKDONJSA-N.
| Molecular formula | C13H18ClNO3 |
|---|---|
| Molecular weight | 271.74 g/mol |
| IUPAC name | tert-butyl N-[(1S)-1-(3-chlorophenyl)-2-hydroxyethyl]carbamate |
| InChIKey | SWYMATJMMKRYJJ-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CO)C1=CC(=CC=C1)Cl |
Computed by PubChem (NCBI)