CAS 66831-17-2 appears in our catalog under these names: H-Hyp(Bzl)-OMe hydrochloride, 97%, H–Hyp(Bzl)–OMe · HCl. Offered by: Combi-blocks, GLPBio. Available pack sizes: 25g, 1g, 5g.
Methyl (2S,4R)-4-phenylmethoxypyrrolidine-2-carboxylate;hydrochloride (CAS 66831-17-2) is a chemical compound with the molecular formula C13H18ClNO3 and a molecular weight of 271.74 g/mol. IUPAC name: methyl (2S,4R)-4-phenylmethoxypyrrolidine-2-carboxylate;hydrochloride. InChIKey: DTGIEBXEDOSJQH-LYCTWNKOSA-N.
| Molecular formula | C13H18ClNO3 |
|---|---|
| Molecular weight | 271.74 g/mol |
| IUPAC name | methyl (2S,4R)-4-phenylmethoxypyrrolidine-2-carboxylate;hydrochloride |
| InChIKey | DTGIEBXEDOSJQH-LYCTWNKOSA-N |
| SMILES | COC(=O)[C@@H]1C[C@H](CN1)OCC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)