cas: 204991-14-0 — see every product listed under this CAS number, including other names
Carbamic acid, N-3-azabicyclo[3.1.0]hex-1-yl-, 1,1-dimethylethyl ester, 98%, 98% (CAS 204991-14-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BI9G-100mg |
| cas | 204991-14-0 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 803.60 Pln | |
| Chemat | 250mg | 1245.20 Pln | |
| Chemat | 500mg | 2195.60 Pln | |
| Chemat | 1g | 3314.00 Pln | |
| Chemat | 5g | 12246.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-(3-azabicyclo[3.1.0]hexan-1-yl)carbamate (CAS 204991-14-0) is a chemical compound with the molecular formula C10H18N2O2 and a molecular weight of 198.26 g/mol. IUPAC name: tert-butyl N-(3-azabicyclo[3.1.0]hexan-1-yl)carbamate. InChIKey: IJHTZGBRXSYOMG-UHFFFAOYSA-N.
| Molecular formula | C10H18N2O2 |
|---|---|
| Molecular weight | 198.26 g/mol |
| IUPAC name | tert-butyl N-(3-azabicyclo[3.1.0]hexan-1-yl)carbamate |
| InChIKey | IJHTZGBRXSYOMG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC12CC1CNC2 |
Computed by PubChem (NCBI)