CAS 1272412-72-2 appears in our catalog under these names: 3,6-Diazaspiro[3.3]heptane-6-carboxylic acid tert-butyl ester hemioxylate, 97%, tert-Butyl 1,6-diazaspiro[3.3]heptane-6-carboxylate 98%, tert-Butyl 1,6-diazaspiro[3.3]heptane-6-carboxylate, 98%, 98%, tert-Butyl 1,6-diazaspiro[3.3]heptane-6-carboxylate, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 50mg, 100mg, 10g.
Tert-butyl 1,6-diazaspiro[3.3]heptane-6-carboxylate (CAS 1272412-72-2) is a chemical compound with the molecular formula C10H18N2O2 and a molecular weight of 198.26 g/mol. IUPAC name: tert-butyl 1,6-diazaspiro[3.3]heptane-6-carboxylate. InChIKey: WDVOLHDNUMLNAK-UHFFFAOYSA-N.
| Molecular formula | C10H18N2O2 |
|---|---|
| Molecular weight | 198.26 g/mol |
| IUPAC name | tert-butyl 1,6-diazaspiro[3.3]heptane-6-carboxylate |
| InChIKey | WDVOLHDNUMLNAK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CCN2 |
Computed by PubChem (NCBI)