CAS 104030-54-8 appears in our catalog under these names: Carpropamid, Carpropamide, >95% (HPLC), Carpropamide, CARPROPAMID <)>97 %, Carpropamid, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: Dr. Ehrenstorfer, TRC, GLPBio, Biosynth, Sigma-Aldrich. Available pack sizes: 100mg, 10mg, 25mg, 5mg, 1x5ml.
2,2-dichloro-N-[1-(4-chlorophenyl)ethyl]-1-ethyl-3-methylcyclopropane-1-carboxamide (CAS 104030-54-8) is a chemical compound with the molecular formula C15H18Cl3NO and a molecular weight of 334.7 g/mol. IUPAC name: 2,2-dichloro-N-[1-(4-chlorophenyl)ethyl]-1-ethyl-3-methylcyclopropane-1-carboxamide. InChIKey: RXDMAYSSBPYBFW-UHFFFAOYSA-N.
| Molecular formula | C15H18Cl3NO |
|---|---|
| Molecular weight | 334.7 g/mol |
| IUPAC name | 2,2-dichloro-N-[1-(4-chlorophenyl)ethyl]-1-ethyl-3-methylcyclopropane-1-carboxamide |
| InChIKey | RXDMAYSSBPYBFW-UHFFFAOYSA-N |
| SMILES | CCC1(C(C1(Cl)Cl)C)C(=O)NC(C)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)