Products 851396-73-1
CAS 851396-73-1 appears in our catalog under these names: Casein kinase 1δ–IN–8, Casein kinase 1δ-IN-8/ 99.66% (existing batch purity), Casein kinase 1δ-IN-8, 98.0%, Casein kinase 1δ-IN-8, ≥98%. Offered by: GLPBio, TargetMol, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 5 mg.
2-[[4-(4-fluorophenyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]-1-(1H-pyrrol-2-yl)ethanone (CAS 851396-73-1) is a chemical compound with the molecular formula C19H14FN5OS and a molecular weight of 379.4 g/mol. IUPAC name: 2-[[4-(4-fluorophenyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]-1-(1H-pyrrol-2-yl)ethanone. InChIKey: NVGJFMZPKBOXQD-UHFFFAOYSA-N.
| Molecular formula | C19H14FN5OS |
|---|---|
| Molecular weight | 379.4 g/mol |
| IUPAC name | 2-[[4-(4-fluorophenyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]-1-(1H-pyrrol-2-yl)ethanone |
| InChIKey | NVGJFMZPKBOXQD-UHFFFAOYSA-N |
| SMILES | C1=CNC(=C1)C(=O)CSC2=NN=C(N2C3=CC=C(C=C3)F)C4=CC=NC=C4 |
Computed by PubChem (NCBI)