Products 225120-65-0
CAS 225120-65-0 appears in our catalog under these names: Cathepsin Inhibitor 1/ 99.68% (existing batch purity), Cathepsin Inhibitor 1, Cathepsin Inhibitor 1, Cathepsin Inhibitor 1, 98%, 98%, Cathepsin inhibitor 1, 99.28%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 2mg.
3-tert-butyl-N-[(2S)-3-(3-chlorophenyl)-1-(cyanomethylamino)-1-oxopropan-2-yl]-1-methylpyrazole-5-carboxamide (CAS 225120-65-0) is a chemical compound with the molecular formula C20H24ClN5O2 and a molecular weight of 401.9 g/mol. IUPAC name: 3-tert-butyl-N-[(2S)-3-(3-chlorophenyl)-1-(cyanomethylamino)-1-oxopropan-2-yl]-1-methylpyrazole-5-carboxamide. InChIKey: MZRVIHRERYCHBL-HNNXBMFYSA-N.
| Molecular formula | C20H24ClN5O2 |
|---|---|
| Molecular weight | 401.9 g/mol |
| IUPAC name | 3-tert-butyl-N-[(2S)-3-(3-chlorophenyl)-1-(cyanomethylamino)-1-oxopropan-2-yl]-1-methylpyrazole-5-carboxamide |
| InChIKey | MZRVIHRERYCHBL-HNNXBMFYSA-N |
| SMILES | CC(C)(C)C1=NN(C(=C1)C(=O)N[C@@H](CC2=CC(=CC=C2)Cl)C(=O)NCC#N)C |
Computed by PubChem (NCBI)