CAS 1276186-19-6 appears in our catalog under these names: Cavutilide/ 99.7% (existing batch purity), Cavutilide. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10 mg, 5 mg.
N-[2-(1-ethylpiperidin-4-yl)-1-(4-fluorophenyl)ethyl]-4-nitrobenzamide (CAS 1276186-19-6) is a chemical compound with the molecular formula C22H26FN3O3 and a molecular weight of 399.5 g/mol. IUPAC name: N-[2-(1-ethylpiperidin-4-yl)-1-(4-fluorophenyl)ethyl]-4-nitrobenzamide. InChIKey: STSQHGMNQPXBLZ-UHFFFAOYSA-N.
| Molecular formula | C22H26FN3O3 |
|---|---|
| Molecular weight | 399.5 g/mol |
| IUPAC name | N-[2-(1-ethylpiperidin-4-yl)-1-(4-fluorophenyl)ethyl]-4-nitrobenzamide |
| InChIKey | STSQHGMNQPXBLZ-UHFFFAOYSA-N |
| SMILES | CCN1CCC(CC1)CC(C2=CC=C(C=C2)F)NC(=O)C3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)