cas: 198828-72-7 — see every product listed under this CAS number, including other names
Cbz-D-Tyr(tBu)-OH·DCHA, 98% (CAS 198828-72-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A146238-1g |
| cas | 198828-72-7 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 153.44 Pln | |
| Ambeed | 5g | 259.12 Pln | |
| Ambeed | 10g | 309.19 Pln | |
| Ambeed | 25g | 642.94 Pln | |
| Ambeed | 100g | 2200.44 Pln | |
| Fluorochem | 1g | 200.99 Pln | |
| Fluorochem | 5g | 383.22 Pln | |
| Fluorochem | 10g | 643.54 Pln | |
| Fluorochem | 25g | 1341.21 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
N-cyclohexylcyclohexanamine;(2R)-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]-2-(phenylmethoxycarbonylamino)propanoic acid (CAS 198828-72-7) is a chemical compound with the molecular formula C33H48N2O5 and a molecular weight of 552.7 g/mol. IUPAC name: N-cyclohexylcyclohexanamine;(2R)-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]-2-(phenylmethoxycarbonylamino)propanoic acid. InChIKey: FDNJRKLIHBJXIR-GMUIIQOCSA-N.
| Molecular formula | C33H48N2O5 |
|---|---|
| Molecular weight | 552.7 g/mol |
| IUPAC name | N-cyclohexylcyclohexanamine;(2R)-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]-2-(phenylmethoxycarbonylamino)propanoic acid |
| InChIKey | FDNJRKLIHBJXIR-GMUIIQOCSA-N |
| SMILES | CC(C)(C)OC1=CC=C(C=C1)C[C@H](C(=O)O)NC(=O)OCC2=CC=CC=C2.C1CCC(CC1)NC2CCCCC2 |
Computed by PubChem (NCBI)