CAS 16879-90-6 appears in our catalog under these names: Z–Tyr(tBu)–OH·DCHA, Z-L-Tyr(tBu)-OH*DCHA, Z-Tyr(tBu)-OH dicyclohexylammonium salt, 98.50%, Cbz-Tyr(tBu)-OH·DCHA 97%, Z-Tyr(tBu)-OH.DCHA, 97%, 97%. Offered by: GLPBio, Iris Biotech, Chemat, Ambeed, MedChemExpress. Available pack sizes: 25g, 5g, 1g, 100g, Get quote.
N-cyclohexylcyclohexanamine;(2S)-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]-2-(phenylmethoxycarbonylamino)propanoic acid (CAS 16879-90-6) is a chemical compound with the molecular formula C33H48N2O5 and a molecular weight of 552.7 g/mol. IUPAC name: N-cyclohexylcyclohexanamine;(2S)-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]-2-(phenylmethoxycarbonylamino)propanoic acid. InChIKey: FDNJRKLIHBJXIR-FERBBOLQSA-N.
| Molecular formula | C33H48N2O5 |
|---|---|
| Molecular weight | 552.7 g/mol |
| IUPAC name | N-cyclohexylcyclohexanamine;(2S)-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]-2-(phenylmethoxycarbonylamino)propanoic acid |
| InChIKey | FDNJRKLIHBJXIR-FERBBOLQSA-N |
| SMILES | CC(C)(C)OC1=CC=C(C=C1)C[C@@H](C(=O)O)NC(=O)OCC2=CC=CC=C2.C1CCC(CC1)NC2CCCCC2 |
Computed by PubChem (NCBI)