Cbz-NH-PEG-C2-acid, 95%, 95%
cas: 1334177-88-6 — see every product listed under this CAS number, including other names
Cbz-NH-PEG-C2-acid, 95%, 95% (CAS 1334177-88-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110IT4-50mg |
| cas | 1334177-88-6 |
| size | 50mg |
| availability | 2g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 386.00 Pln | |
| Chemat | 100mg | 611.60 Pln | |
| Chemat | 250mg | 1216.40 Pln | |
| Chemat | 1g | 3294.80 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(phenylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1334177-88-6) is a chemical compound with the molecular formula C35H61NO16 and a molecular weight of 751.9 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(phenylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: WVKANAHNXOWXKU-UHFFFAOYSA-N.
| Molecular formula | C35H61NO16 |
|---|---|
| Molecular weight | 751.9 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(phenylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | WVKANAHNXOWXKU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)