cas: 1334177-88-6 — see every product listed under this CAS number, including other names
Cbz-NH-PEG12-C2-acid, 95% +PEG(12) (CAS 1334177-88-6) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1282526-1g |
| cas | 1334177-88-6 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 18350.08 Pln |
| purity | 95% +PEG(12) |
|---|---|
| delivery time | To be confirmed by Chemat |
3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(phenylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1334177-88-6) is a chemical compound with the molecular formula C35H61NO16 and a molecular weight of 751.9 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(phenylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: WVKANAHNXOWXKU-UHFFFAOYSA-N.
| Molecular formula | C35H61NO16 |
|---|---|
| Molecular weight | 751.9 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(phenylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | WVKANAHNXOWXKU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)