cas: 26787-76-8 — see every product listed under this CAS number, including other names
Cbz-Phg(4-OH)-OH 98% (CAS 26787-76-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1186660-1g |
| cas | 26787-76-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 164.56 Pln | |
| Ambeed | 5g | 303.62 Pln | |
| Ambeed | 25g | 776.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1186660 |
(2S)-2-(4-hydroxyphenyl)-2-(phenylmethoxycarbonylamino)acetic acid (CAS 26787-76-8) is a chemical compound with the molecular formula C16H15NO5 and a molecular weight of 301.29 g/mol. IUPAC name: (2S)-2-(4-hydroxyphenyl)-2-(phenylmethoxycarbonylamino)acetic acid. InChIKey: CGDQNVNWDDEJPY-AWEZNQCLSA-N.
| Molecular formula | C16H15NO5 |
|---|---|
| Molecular weight | 301.29 g/mol |
| IUPAC name | (2S)-2-(4-hydroxyphenyl)-2-(phenylmethoxycarbonylamino)acetic acid |
| InChIKey | CGDQNVNWDDEJPY-AWEZNQCLSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@@H](C2=CC=C(C=C2)O)C(=O)O |
Computed by PubChem (NCBI)