CAS 26787-76-8 appears in our catalog under these names: (2S)-2-{[(benzyloxy)carbonyl]amino}-2-(4-hydroxyphenyl)acetic acid, 95%, N–Cbz–S–4–Hydroxyphenylglycine, Cbz-Phg(4-OH)-OH 98%. Offered by: Combi-blocks, GLPBio, Ambeed. Available pack sizes: 25g, 1g, 5g.
(2S)-2-(4-hydroxyphenyl)-2-(phenylmethoxycarbonylamino)acetic acid (CAS 26787-76-8) is a chemical compound with the molecular formula C16H15NO5 and a molecular weight of 301.29 g/mol. IUPAC name: (2S)-2-(4-hydroxyphenyl)-2-(phenylmethoxycarbonylamino)acetic acid. InChIKey: CGDQNVNWDDEJPY-AWEZNQCLSA-N.
| Molecular formula | C16H15NO5 |
|---|---|
| Molecular weight | 301.29 g/mol |
| IUPAC name | (2S)-2-(4-hydroxyphenyl)-2-(phenylmethoxycarbonylamino)acetic acid |
| InChIKey | CGDQNVNWDDEJPY-AWEZNQCLSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@@H](C2=CC=C(C=C2)O)C(=O)O |
Computed by PubChem (NCBI)