CAS 57961-90-7 appears in our catalog under these names: Centhaquin, Centhaquin/ 99.83% (existing batch purity), Centhaquin, 99.85% ,, 99.85% ,, Centhaquin, 99.93%, Centhaquin (Standard). Offered by: TRC, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 100mg, 5mg, 10mg, 25mg, 50mg, 10mM (in 1ml dmso), 1mg, 200mg.
2-[2-[4-(3-methylphenyl)piperazin-1-yl]ethyl]quinoline (CAS 57961-90-7) is a chemical compound with the molecular formula C22H25N3 and a molecular weight of 331.5 g/mol. IUPAC name: 2-[2-[4-(3-methylphenyl)piperazin-1-yl]ethyl]quinoline. InChIKey: UJNWGFBJUHIJKK-UHFFFAOYSA-N.
| Molecular formula | C22H25N3 |
|---|---|
| Molecular weight | 331.5 g/mol |
| IUPAC name | 2-[2-[4-(3-methylphenyl)piperazin-1-yl]ethyl]quinoline |
| InChIKey | UJNWGFBJUHIJKK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)N2CCN(CC2)CCC3=NC4=CC=CC=C4C=C3 |
Computed by PubChem (NCBI)