Products 332117-28-9
CAS 332117-28-9 appears in our catalog under these names: Chembridge-5861528/ 100%, TCS 5861528, Chembridge-5861528, N-(4-(sec-Butyl)phenyl)-2-(1,3-dimethyl-2,6-dioxo-1,2,3,6-tetrahydro-7H-purin-7-yl)acetamide, Chembridge-5861528, 99.12%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso), 1mg.
N-(4-butan-2-ylphenyl)-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetamide (CAS 332117-28-9) is a chemical compound with the molecular formula C19H23N5O3 and a molecular weight of 369.4 g/mol. IUPAC name: N-(4-butan-2-ylphenyl)-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetamide. InChIKey: ZUTUWJYMCADJHD-UHFFFAOYSA-N.
| Molecular formula | C19H23N5O3 |
|---|---|
| Molecular weight | 369.4 g/mol |
| IUPAC name | N-(4-butan-2-ylphenyl)-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetamide |
| InChIKey | ZUTUWJYMCADJHD-UHFFFAOYSA-N |
| SMILES | CCC(C)C1=CC=C(C=C1)NC(=O)CN2C=NC3=C2C(=O)N(C(=O)N3C)C |
Computed by PubChem (NCBI)