CAS 1256349-48-0 appears in our catalog under these names: Chiauranib, Chiauranib/ 96.25% (existing batch purity), N-(2-Aminophenyl)-6-[(7-methoxy-4-quinolinyl)oxy]-1-naphthalenecarboxamide, 95%, 95%, Chiauranib, 98.28%, Chiauranib, 95%+. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 10mg, 100mg, 10mM (in 1ml dmso), 25mg, 5mg, 50mg, 1mg, 250mg.
N-(2-aminophenyl)-6-(7-methoxyquinolin-4-yl)oxynaphthalene-1-carboxamide (CAS 1256349-48-0) is a chemical compound with the molecular formula C27H21N3O3 and a molecular weight of 435.5 g/mol. IUPAC name: N-(2-aminophenyl)-6-(7-methoxyquinolin-4-yl)oxynaphthalene-1-carboxamide. InChIKey: BRKWREZNORONDU-UHFFFAOYSA-N.
| Molecular formula | C27H21N3O3 |
|---|---|
| Molecular weight | 435.5 g/mol |
| IUPAC name | N-(2-aminophenyl)-6-(7-methoxyquinolin-4-yl)oxynaphthalene-1-carboxamide |
| InChIKey | BRKWREZNORONDU-UHFFFAOYSA-N |
| SMILES | COC1=CC2=NC=CC(=C2C=C1)OC3=CC4=C(C=C3)C(=CC=C4)C(=O)NC5=CC=CC=C5N |
Computed by PubChem (NCBI)