cas: 1375325-64-6 — see every product listed under this CAS number, including other names
Chloro(2-dicyclohexylphosphino-2',6'-dimethoxy-1,1'-biphenyl)[2-(2'-amino-1,1'-biphenyl)]palladium(II), 98%, 98% (CAS 1375325-64-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110BK1-100mg |
| cas | 1375325-64-6 |
| size | 100mg |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 160.40 Pln | |
| Chemat | 5g | 539.60 Pln | |
| Chemat | 25g | 2421.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Chloropalladium(1+);dicyclohexyl-[2-(2,6-dimethoxyphenyl)phenyl]phosphane;2-phenylaniline (CAS 1375325-64-6) is a chemical compound with the molecular formula C38H45ClNO2PPd and a molecular weight of 720.6 g/mol. IUPAC name: chloropalladium(1+);dicyclohexyl-[2-(2,6-dimethoxyphenyl)phenyl]phosphane;2-phenylaniline. InChIKey: HODHLQXRQOHAAZ-UHFFFAOYSA-M.
| Molecular formula | C38H45ClNO2PPd |
|---|---|
| Molecular weight | 720.6 g/mol |
| IUPAC name | chloropalladium(1+);dicyclohexyl-[2-(2,6-dimethoxyphenyl)phenyl]phosphane;2-phenylaniline |
| InChIKey | HODHLQXRQOHAAZ-UHFFFAOYSA-M |
| SMILES | COC1=C(C(=CC=C1)OC)C2=CC=CC=C2P(C3CCCCC3)C4CCCCC4.C1=CC=C([C-]=C1)C2=CC=CC=C2N.Cl[Pd+] |
Computed by PubChem (NCBI)