cas: 1375325-64-6 — see every product listed under this CAS number, including other names
SPhos Pd G2, 98% (CAS 1375325-64-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F549883-100MG |
| cas | 1375325-64-6 |
| size | 100mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 117.68 Pln | |
| Fluorochem | 250mg | 133.30 Pln | |
| Fluorochem | 1g | 185.37 Pln | |
| Fluorochem | 5g | 633.13 Pln | |
| Fluorochem | 10g | 1185.02 Pln | |
| Fluorochem | 25g | 2856.30 Pln | |
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 225.75 Pln | |
| Ambeed | 5g | 615.13 Pln | |
| Ambeed | 25g | 2767.81 Pln |
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
Chloropalladium(1+);dicyclohexyl-[2-(2,6-dimethoxyphenyl)phenyl]phosphane;2-phenylaniline (CAS 1375325-64-6) is a chemical compound with the molecular formula C38H45ClNO2PPd and a molecular weight of 720.6 g/mol. IUPAC name: chloropalladium(1+);dicyclohexyl-[2-(2,6-dimethoxyphenyl)phenyl]phosphane;2-phenylaniline. InChIKey: HODHLQXRQOHAAZ-UHFFFAOYSA-M.
| Molecular formula | C38H45ClNO2PPd |
|---|---|
| Molecular weight | 720.6 g/mol |
| IUPAC name | chloropalladium(1+);dicyclohexyl-[2-(2,6-dimethoxyphenyl)phenyl]phosphane;2-phenylaniline |
| InChIKey | HODHLQXRQOHAAZ-UHFFFAOYSA-M |
| SMILES | COC1=C(C(=CC=C1)OC)C2=CC=CC=C2P(C3CCCCC3)C4CCCCC4.C1=CC=C([C-]=C1)C2=CC=CC=C2N.Cl[Pd+] |
Computed by PubChem (NCBI)