cas: 344-07-0 — see every product listed under this CAS number, including other names
Chloropentafluorobenzene, 98%, 98% (CAS 344-07-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114OUF-5g |
| cas | 344-07-0 |
| size | 5g |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 93.20 Pln | |
| Chemat | 25g | 112.40 Pln | |
| Chemat | 100g | 237.20 Pln | |
| Chemat | 500g | 825.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-chloro-2,3,4,5,6-pentafluorobenzene (CAS 344-07-0) is a chemical compound with the molecular formula C6ClF5 and a molecular weight of 202.51 g/mol. IUPAC name: 1-chloro-2,3,4,5,6-pentafluorobenzene. InChIKey: KGCDGLXSBHJAHZ-UHFFFAOYSA-N.
| Molecular formula | C6ClF5 |
|---|---|
| Molecular weight | 202.51 g/mol |
| IUPAC name | 1-chloro-2,3,4,5,6-pentafluorobenzene |
| InChIKey | KGCDGLXSBHJAHZ-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)F)Cl)F)F)F |
Computed by PubChem (NCBI)