cas: 344-07-0 — see every product listed under this CAS number, including other names
Chloropentafluorobenzene, 98% (CAS 344-07-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 25g, 5g, 10g, 100g, 500g. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | YF-5241-1g |
| cas | 344-07-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 5g | price on request | |
| Fluorochem | 1g | 96.86 Pln | |
| Fluorochem | 5g | 102.07 Pln | |
| Fluorochem | 10g | 128.10 Pln | |
| Fluorochem | 25g | 159.34 Pln | |
| Fluorochem | 100g | 362.39 Pln | |
| Fluorochem | 500g | 1226.67 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
1-chloro-2,3,4,5,6-pentafluorobenzene (CAS 344-07-0) is a chemical compound with the molecular formula C6ClF5 and a molecular weight of 202.51 g/mol. IUPAC name: 1-chloro-2,3,4,5,6-pentafluorobenzene. InChIKey: KGCDGLXSBHJAHZ-UHFFFAOYSA-N.
| Molecular formula | C6ClF5 |
|---|---|
| Molecular weight | 202.51 g/mol |
| IUPAC name | 1-chloro-2,3,4,5,6-pentafluorobenzene |
| InChIKey | KGCDGLXSBHJAHZ-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)F)Cl)F)F)F |
Computed by PubChem (NCBI)