cas: 50-63-5 — see every product listed under this CAS number, including other names
Chloroquine phosphate 98% (CAS 50-63-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A233637-100mg |
| cas | 50-63-5 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 120.06 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 147.88 Pln | |
| Ambeed | 25g | 197.94 Pln | |
| Ambeed | 100g | 498.31 Pln | |
| Ambeed | 500g | 1110.19 Pln | |
| Ambeed | 1000g | 2150.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A233637 |
4-N-(7-chloroquinolin-4-yl)-1-N,1-N-diethylpentane-1,4-diamine;phosphoric acid (CAS 50-63-5) is a chemical compound with the molecular formula C18H29ClN3O4P and a molecular weight of 417.9 g/mol. IUPAC name: 4-N-(7-chloroquinolin-4-yl)-1-N,1-N-diethylpentane-1,4-diamine;phosphoric acid. InChIKey: AEUAEICGCMSYCQ-UHFFFAOYSA-N.
| Molecular formula | C18H29ClN3O4P |
|---|---|
| Molecular weight | 417.9 g/mol |
| IUPAC name | 4-N-(7-chloroquinolin-4-yl)-1-N,1-N-diethylpentane-1,4-diamine;phosphoric acid |
| InChIKey | AEUAEICGCMSYCQ-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCCC(C)NC1=C2C=CC(=CC2=NC=C1)Cl.OP(=O)(O)O |
Computed by PubChem (NCBI)