CAS 50-63-5 appears in our catalog under these names: Chloroquine diphosphate, Concentration: 100 µg/ml Solvent: Acetonitrile/Water 50/50, 6–Maleimidohexanoic acid N–hydroxysuccinimide ester (EMCS), Chloroquine Diphosphate, Chloroquine Diphosphate Salt, >95% (HPLC), Chloroquine Phosphate. Offered by: HPC Standards, GLPBio, Chemat Brand, TRC, Dr. Ehrenstorfer. Available pack sizes: 1x1ml, 50mg, on request, 100mg, 10mg, 250mg, 200mg, 500mg.
4-N-(7-chloroquinolin-4-yl)-1-N,1-N-diethylpentane-1,4-diamine;phosphoric acid (CAS 50-63-5) is a chemical compound with the molecular formula C18H29ClN3O4P and a molecular weight of 417.9 g/mol. IUPAC name: 4-N-(7-chloroquinolin-4-yl)-1-N,1-N-diethylpentane-1,4-diamine;phosphoric acid. InChIKey: AEUAEICGCMSYCQ-UHFFFAOYSA-N.
| Molecular formula | C18H29ClN3O4P |
|---|---|
| Molecular weight | 417.9 g/mol |
| IUPAC name | 4-N-(7-chloroquinolin-4-yl)-1-N,1-N-diethylpentane-1,4-diamine;phosphoric acid |
| InChIKey | AEUAEICGCMSYCQ-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCCC(C)NC1=C2C=CC(=CC2=NC=C1)Cl.OP(=O)(O)O |
Computed by PubChem (NCBI)