cas: 206986-88-1 — see every product listed under this CAS number, including other names
Cinchonine HCl hydrate, 98+% (CAS 206986-88-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1186827-1g |
| cas | 206986-88-1 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 330.40 Pln | |
| AmBeed | 5g | 519.19 Pln |
| purity | 98+% |
|---|---|
| delivery time | To be confirmed by Chemat |
(S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol;hydrate;hydrochloride (CAS 206986-88-1) is a chemical compound with the molecular formula C19H25ClN2O2 and a molecular weight of 348.9 g/mol. IUPAC name: (S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol;hydrate;hydrochloride. InChIKey: BJPKGJFSLFTZSO-OPMVAYRNSA-N.
| Molecular formula | C19H25ClN2O2 |
|---|---|
| Molecular weight | 348.9 g/mol |
| IUPAC name | (S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol;hydrate;hydrochloride |
| InChIKey | BJPKGJFSLFTZSO-OPMVAYRNSA-N |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@@H]2[C@H](C3=CC=NC4=CC=CC=C34)O.O.Cl |
Computed by PubChem (NCBI)