CAS 206986-88-1 appears in our catalog under these names: Cinchonine monohydrochloride hydrate, 80%, Cinchonine HCl hydrate, 98+%, Cinchonine monohydrochloride hydrate, CINCHONINE MONOHYDROCHLORIDE HYDRATE, 9&, Cinchonine (monohydrochloride hydrate). Offered by: Combi-blocks, AmBeed, TargetMol, Sigma-Aldrich, MedChemExpress. Available pack sizes: 25g, 5g, 1g, 25mg, 50mg, 100mg, 10mg, 5mg.
(S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol;hydrate;hydrochloride (CAS 206986-88-1) is a chemical compound with the molecular formula C19H25ClN2O2 and a molecular weight of 348.9 g/mol. IUPAC name: (S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol;hydrate;hydrochloride. InChIKey: BJPKGJFSLFTZSO-OPMVAYRNSA-N.
| Molecular formula | C19H25ClN2O2 |
|---|---|
| Molecular weight | 348.9 g/mol |
| IUPAC name | (S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol;hydrate;hydrochloride |
| InChIKey | BJPKGJFSLFTZSO-OPMVAYRNSA-N |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@@H]2[C@H](C3=CC=NC4=CC=CC=C34)O.O.Cl |
Computed by PubChem (NCBI)